| Autor: |
Eric G. Morales-Espinosa, Naytze Ortiz-Pastrana, Valente Gómez-Benítez, Reyna Reyes-Martínez, Hilda Amelia Piñón-Castillo, Laura A. Manjarrez-Nevárez, Juan M. German-Acacio, David Morales-Morales |
| Jazyk: |
angličtina |
| Rok vydání: |
2022 |
| Předmět: |
|
| Zdroj: |
Molbank, Vol 2022, Iss 2, p M1359 (2022) |
| Druh dokumentu: |
article |
| ISSN: |
1422-8599 |
| DOI: |
10.3390/M1359 |
| Popis: |
Among their many applications, metal pincer complexes are of interest for their properties as catalysts in cross-coupling reactions. Pincer ligands exhibit tridentate coordination to the metal center and occupy the meridional positions forming two chelate rings. The two Ni(II) POCOP pincer complexes with a fluorothiophenolate ligand reported herein, with formulas [Ni(SC6F4-4-H){C6H2-3-(C2H3O)-2,6-(OPiPr2)2}] (2) and [Ni(SC6F5){C6H2-3-(C2H3O)-2,6-(OPiPr2)2}] (3), are isostructural. Additionally, they are prepared in a facile manner from the chloride compound [NiCl{C6H2-3-(C2H3O)-2-6-(OPiPr2)2}] (1). The complexes exhibited slightly distorted square planar geometries around the metal. The fluorothiophenolate ligands are responsible of the C—H···F, C—F···π and C=O···πF interactions that contribute to stabilize the crystal structure arrays. |
| Databáze: |
Directory of Open Access Journals |
| Externí odkaz: |
|
|
Nepřihlášeným uživatelům se plný text nezobrazuje |
K zobrazení výsledku je třeba se přihlásit.
|
