Synthesis and helical structure of poly (N-butynylamide)s having various side chains, where the Helix is highly affected by the methyl branch and the lactone moiety
Autor: | Toshio Masuda, Yoshihito Inai, Junichi Tabei, Fumio Sanda, Masashi Shiotsuki, Yuji Suzuki |
---|---|
Jazyk: | angličtina |
Rok vydání: | 2008 |
Předmět: | |
Zdroj: | MACROMOLECULES. 41(4):1086-1093 |
ISSN: | 0024-9297 |
Popis: | N-Butynylamides, (S)-HC⋮CCH2CH2NHCOCH2CH(CH3)CH2CH3 (1), (R)-HC⋮CCH2CH2NHCOCH2CH(CH3)CH2CH2CH2CH(CH3)2 (2), (S)-HC⋮CCH2CH2NHCOCH(CH3)CH2CH2CH2CH2CH2CH3 (3), (1S)-HC⋮CCH2CH2NHCOC9H13O2 (4, COC9H13O2... |
Databáze: | OpenAIRE |
Externí odkaz: |