Synthesis and helical structure of poly (N-butynylamide)s having various side chains, where the Helix is highly affected by the methyl branch and the lactone moiety

Autor:	Toshio Masuda, Yoshihito Inai, Junichi Tabei, Fumio Sanda, Masashi Shiotsuki, Yuji Suzuki
Jazyk:	angličtina
Rok vydání:	2008
Předmět:	Persistence length chemistry.chemical_classification Polymers and Plastics Stereochemistry medicine.drug_class Chemistry Organic Chemistry Carboxamide Solution polymerization Inorganic Chemistry Helix Materials Chemistry medicine Side chain Moiety Solvent effects Lactone
Zdroj:	MACROMOLECULES. 41(4):1086-1093
ISSN:	0024-9297
Popis:	N-Butynylamides, (S)-HC⋮CCH2CH2NHCOCH2CH(CH3)CH2CH3 (1), (R)-HC⋮CCH2CH2NHCOCH2CH(CH3)CH2CH2CH2CH(CH3)2 (2), (S)-HC⋮CCH2CH2NHCOCH(CH3)CH2CH2CH2CH2CH2CH3 (3), (1S)-HC⋮CCH2CH2NHCOC9H13O2 (4, COC9H13O2...
Databáze:	OpenAIRE
Externí odkaz:	https://explore.openaire.eu/search/publication?articleId=doi_dedup___::50d89ecf8d5fe3e6a55d519fd008ff41 http://hdl.handle.net/2433/79150 Zobrazit plný text záznamu