Reduction of the heterobimetallic .mu.-.eta.1(C):.eta.2(O,O')-CO2 complex Cp(CO)2Ru(CO2)Zr(Cl)Cp2 to its .mu.-.eta.1(C):.eta.1(O)-formaldehyde derivative Cp(CO)2Ru(CH2O)Zr(Cl)Cp2: hydride transfer occurs at ligated carbon monoxide
| Autor: | Alan R. Cutler, Jose C. Vites, Bryan D. Steffey |
|---|---|
| Rok vydání: | 1991 |
| Předmět: |
chemistry.chemical_classification
Reaction mechanism Hydride Organic Chemistry Inorganic chemistry Formaldehyde chemistry.chemical_element Aldehyde Medicinal chemistry Inorganic Chemistry chemistry.chemical_compound chemistry Physical and Theoretical Chemistry Metallocene Carbon Derivative (chemistry) Carbon monoxide |
| Zdroj: | Organometallics. 10:3432-3435 |
| ISSN: | 1520-6041 0276-7333 |
| DOI: | 10.1021/om00056a010 |
| Databáze: | OpenAIRE |
| Externí odkaz: |
|