Acylative Dimerization of Tetrahydrofuran Catalyzed by Rare‐Earth Triflates

Autor:	Daniel A. Ruddy, Samira Tinorgah, Rebecca L. Geisler, William H. Miles
Rok vydání:	2004
Předmět:	Organic Chemistry chemistry.chemical_element Medicinal chemistry Catalysis chemistry.chemical_compound Acetic anhydride chemistry Yield (chemistry) Lanthanum Organic chemistry lipids (amino acids peptides and proteins) Scandium Lewis acids and bases Trifluoromethanesulfonate Tetrahydrofuran
Zdroj:	Synthetic Communications. 34:1871-1880
ISSN:	1532-2432 0039-7911
DOI:	10.1081/scc-120034170
Popis:	Ytterbium, scandium, and lanthanum triflates catalyze the cleavage reactions of cyclic ethers to give various products. Most notable was the acylative cleavage of tetrahydrofuran with acetic anhydride catalyzed by Yb(triflate)3 to give the dimeric compound CH3CO2(CH2)4O(CH2)4OCOCH3 in 69% yield.
Databáze:	OpenAIRE
Externí odkaz:	https://explore.openaire.eu/search/publication?articleId=doi_________::e96fa2e47a456aadbe9f77d2d9abd2ca https://doi.org/10.1081/scc-120034170 Zobrazit plný text záznamu Plný text ve formátu PDF Plný text ve formátu HTML
Nepřihlášeným uživatelům se plný text nezobrazuje	K zobrazení výsledku je třeba se přihlásit.