Synthesis, characterization and crystal structures of (Z)-1-(triarylstannyl)-3-phenyl-1-buten-3-ols and their arylhalostannyl derivatives
| Autor: | Ying Mu, Zong-Mu Wang, Wei Gao, Ze-Min Mei, Dong-Sheng Zhu, Chunsheng Lü, Yuetao Zhang |
|---|---|
| Rok vydání: | 2003 |
| Předmět: |
Stereochemistry
Aryl Tetrahedral molecular geometry Crystal structure Nuclear magnetic resonance spectroscopy Inorganic Chemistry chemistry.chemical_compound Trigonal bipyramidal molecular geometry Crystallography chemistry Intramolecular force Materials Chemistry Proton NMR Physical and Theoretical Chemistry Single crystal |
| Zdroj: | Polyhedron. 22:3523-3527 |
| ISSN: | 0277-5387 |
| DOI: | 10.1016/j.poly.2003.09.012 |
| Popis: | (Z)-1-(tri-o-tolylstannyl)-3-phenyl-1-buten-3-ol (1) and (Z)-1-(tri-p-tolylstannyl)-3-phenyl-1-buten-3-ol (2) were synthesized by the additive reaction of 3-phenyl-1-butyn-3-ol with tri-o-tolyltin and tri-p-tolyltin hydrides. One of the aryl groups in compounds 1 and 2 was substituted by Cl, Br, I to yield derivatives of the type PhC(CH3)(OH)CHCHSn(aryl)2X [aryl=o-tolyl, X=Cl (3); aryl=p-tolyl, X=Cl (4); aryl=o-tolyl, X=Br (5); aryl=p-tolyl, X=Br (6); aryl=o-tolyl, X=I (7); aryl=p-tolyl, X=I (8)]. Compounds 1–8 were characterized by elemental analysis, 1H NMR and FT-IR spectroscopy. The crystal structures of 1, 2 and 5 have been determined by single crystal X-ray diffraction analysis. The Sn atom in 1 and 2 exhibits tetrahedral geometry distorted towards trigonal bipyramidal due to a weak intramolecular interaction between Sn and the hydroxyl O atoms [2.879(5) and 2.859(4) A], while the Sn atom in 5 adopts a trigonal bipyramidal geometry with a significant Sn(1) ← O interaction [2.483(4) A]. |
| Databáze: | OpenAIRE |
| Externí odkaz: |
|
Full Text from ScienceDirect