Synthesis and Structural Characterization of Mono‐ and Bimetallic Rhodium(I), Iridium(I) and Gold(I) Methanide and Methandiide Complexes from 2‐Quinolyl‐Linked (Thiophosphoranyl)methane
| Autor: | Yuk-Chi Chan, Tsz-Hei Choi, Hung Kay Lee, Wing-Por Leung |
|---|---|
| Rok vydání: | 2016 |
| Předmět: |
Geminal
010405 organic chemistry Stereochemistry chemistry.chemical_element 010402 general chemistry 01 natural sciences Medicinal chemistry 0104 chemical sciences Rhodium Inorganic Chemistry Metal chemistry.chemical_compound Monomer chemistry visual_art visual_art.visual_art_medium Salt metathesis reaction Iridium Bimetallic strip Carbene |
| Zdroj: | European Journal of Inorganic Chemistry. 2016:3859-3867 |
| ISSN: | 1099-0682 1434-1948 |
| DOI: | 10.1002/ejic.201600328 |
| Popis: | The synthesis and structural characterization of RhI, IrI and AuI metal complexes derived from 2-quinolyl-linked (thiophosphoranyl)methane CH2(iPr2P=S)(C9H6N-2) (A) are reported. Metathesis reactions of 2-quinolyl-thiophosphinoyl potassium complex [K{CH(iPr2P-S)(C9H6N-2)}]n (1) with 1 equiv. of [MCl(COD)]2 (M = Rh, Ir; COD = cycloocta-1,5-diene) afforded monomeric 2-quinolyl-thiophosphinoyl-rhodium(I) and iridium(I) complex [M(COD){CH(iPr2P=S)(C9H6N-2)}] {M = Rh (2), Ir (3)}, respectively. Upon treatment of 1 with 2 equiv. of [MCl(COD)]2 (M = Ir, Rh), bimetallic complexes [M(COD){CH(iPr2P=S)(C9H6N-2)(M(COD)Cl)}] {M = Rh (4), Ir (5)} were obtained. The reaction of 1 with [AuCl(PPh3)] afforded a geminal dinuclear gold(I) methandiide complex [{Au(PPh3)}2{C(iPr2P-S)(C9H6N-2)}] (6), featuring an aurophilic interaction. Meanwhile, the metathesis reaction of 1 with 1 equiv. of gold(I) complex [AuCl(IPrNHC)] {IPrNHC = C[N(2,6-iPr2C6H3)CH]2} afforded a monomeric two-coordinate monoaurated product, 2-quinolyl-thiophosphinoyl-gold(I) N-heterocyclic carbene complex [Au(IPrNHC){CH(iPr2P-S)(C9H6N-2)}] (7). The structures of 3–7 have been determined by X-ray crystallography and the UV/Vis absorption properties of 2–6 have also been studied. |
| Databáze: | OpenAIRE |
| Externí odkaz: |
|
| Nepřihlášeným uživatelům se plný text nezobrazuje | K zobrazení výsledku je třeba se přihlásit. |