Chemical properties of organotitanium compounds containing a ?silaneopentyl?' group

Autor:	M. B. Sergeeva, Vladimir G. Zaikin, V. M. Vdovin, N. B. Bespalova
Rok vydání:	1981
Předmět:	chemistry.chemical_compound Hydrolysis Chemistry Group (periodic table) Thermal decomposition Polymer chemistry Halogen Titanium tetrachloride Organic chemistry Reactivity (chemistry) General Chemistry Cleavage (embryo) Hydrogen chloride
Zdroj:	Bulletin of the Academy of Sciences of the USSR Division of Chemical Science. 30:1295-1299
ISSN:	1573-9171 0568-5230
DOI:	10.1007/bf01417993
Popis:	1. In the product from the reaction of titanium tetrachloride with 1,1,3,3-tetramethyl-1,3-disilacyclobutane Cl3TiCH2Si(CH3)2CH2Si(CH3)2Cl the Ti-C bond is thermally more stable than that in organotitanium trichlorides but is cleaved fairly readily by the action of halogen, hydrogen chloride, and by hydrolysis. 2. The enhanced reactivity of the C-Si bond adjacent to the titanium atom in thermolysis, hydrolysis, and cleavage with hydrogen chloride was established.
Databáze:	OpenAIRE
Externí odkaz:	https://explore.openaire.eu/search/publication?articleId=doi_________::6f4b162f13304d512c95b397b154abda https://doi.org/10.1007/bf01417993 Zobrazit plný text záznamu Full text from SpringerLink