Diphenylbenchrotrenylphosphine - a new two-electron ligand in carbonyl-containing π-aromatic chromium and manganese complexes and in carbonyls of group vib metals
| Autor: | M.N. Esthekhina, V. N. Setkina, V. I. Losilkina, N. K. Baranetskaya |
|---|---|
| Rok vydání: | 1986 |
| Předmět: |
Ligand
Chemical shift Organic Chemistry Inorganic chemistry chemistry.chemical_element Protonation Manganese Nuclear magnetic resonance spectroscopy Carbon-13 NMR Biochemistry Medicinal chemistry Inorganic Chemistry Metal Chromium chemistry visual_art Materials Chemistry visual_art.visual_art_medium Physical and Theoretical Chemistry |
| Zdroj: | Journal of Organometallic Chemistry. 299:187-195 |
| ISSN: | 0022-328X |
| Popis: | Photochemical substitution of CO ligands in C6H6Cr(CO)3, C5H5Mn(CO)3 and M(CO)6 (M = Cr, Mo, W) for PPh2C6H5Cr(CO)3, ligands was used to synthesize novel complexes: C6H6Cr(CO)2PPh2C6H5Cr(CO)3, C5H5Mn(CO)2PPh2C6H5Cr (CO)3 and M(CO)5PPh2C6H5Cr(CO)3. The complexes obtained have been characterized by elemental analysis, IR, 1H, 13C, 31P NMR, and mass spectra. The protonation reaction and the hydrogen isotopic exchange of arenechromium carbonyl complexes in acid media have been studied. The 13C NMR spectra of M(CO)5PPh2C6H5Cr(CO)3 show that the nature of the central metal atom influences the chemical shifts of the carbon nuclei of the carbonyl groups, shielding these atoms, increasing in the series W ⩽ Mo < Cr. |
| Databáze: | OpenAIRE |
| Externí odkaz: |
|