Crystal structure of diaqua-monodimethylglycine-hexakis(μ2-dimethylglycine- O:O)-μ3-oxo-triiron(III) heptanitrate—water—dimethylgycine solvate (1:4:0.63), Fe3O(C4H9NO2)7(H2O)2(NO3)7 · 4H2O · 0.63C4H9NO2
| Autor: | Ramos Silva M., Matos Beja A., Paixão J. A., Martin-Gil J. |
|---|---|
| Jazyk: | angličtina |
| Rok vydání: | 2003 |
| Předmět: | |
| Zdroj: | Zeitschrift für Kristallographie - New Crystal Structures, Vol 218, Iss 4, Pp 557-560 (2003) |
| Druh dokumentu: | article |
| ISSN: | 1433-7266 2197-4578 |
| DOI: | 10.1524/ncrs.2003.218.4.557 |
| Popis: | C30.20H80.60Fe3N14.30O43.26, triclinic, P1̅ (No. 2), a = 12.424(6) Å, b = 16.565(5) Å, c = 17.627(3) Å, α = 90.59(4)°, β = 101.48(4)°, γ = 108.97(4)°, V = 3351.1 Å3, Z = 2, Rgt(F) = 0.070, wRref(F2) = 0.261, T = 293 K. |
| Databáze: | Directory of Open Access Journals |
| Externí odkaz: |
|