Synthesis and study of an unprecedented 1-hydro-1-lithio-1-silafluorene anion

Autor:	Hongfan Hu, Tianhao Li, YuanYuan Liu, Xiaofei Li, Dawei Tian, Yue Cao, Chunming Cui
Rok vydání:	2016
Předmět:	010405 organic chemistry Crystal structure 010402 general chemistry 01 natural sciences 0104 chemical sciences Inorganic Chemistry chemistry.chemical_compound chemistry Reagent Polymer chemistry Electrophile Molecule Organic chemistry Tetrahydrofuran Bond cleavage Phosphine Isopropyl
Zdroj:	Dalton Transactions. 45:18447-18449
ISSN:	1477-9234 1477-9226
DOI:	10.1039/c6dt02533a
Popis:	The 1-hydro-1-lithio-silafluorene anion 2 has been isolated and characterized by single-crystal X-ray analysis for the first time. Three tetrahydrofuran molecules coordinate with lithium atoms in the crystal structure of 2. 2 was reacted with a number of electrophilic reagents and it can be used as a useful reagent for generating various functional hydrogen-substituted silafluorenes. Treatment of 2 with 2 equiv. of chlorobis(isopropyl)phosphine afforded chloro-substituted silafluorene 4. The reaction of 8 which has a SiH-SiBr fragment with IiPr2Me2 (IiPr2: 2,5-diisopropyl-3,4-dimethylimidazol-1-ylidene) led to the formation of an Si-Si bond cleavage product, NHC-stabilized silacyclopentadienylidene 9.
Databáze:	OpenAIRE
Externí odkaz:	https://explore.openaire.eu/search/publication?articleId=doi_dedup___::091eb9cbc08439cf6500a3d0869389a2 https://doi.org/10.1039/c6dt02533a Zobrazit plný text záznamu